C19H19N3O — CID 8810657
N,4-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide (PubChem CID 8810657) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is N,4-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide.
| Compound Name | N,4-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 8810657 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N,4-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
| SMILES | Cc1ccc(C(=O)N(C)Cc2cnn(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C19H19N3O/c1-15-8-10-17(11-9-15)19(23)21(2)13-16-12-20-22(14-16)18-6-4-3-5-7-18/h3-12,14H,13H2,1-2H3 |
| InChIKey | WFPPBMRKHQPKQA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |