C17H12Cl3N3O — CID 86968465
2,3-dichloro-N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]benzamide (PubChem CID 86968465) has the molecular formula C17H12Cl3N3O and a molecular weight of 380.66 g/mol. Its IUPAC name is 2,3-dichloro-N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]benzamide.
| Compound Name | 2,3-dichloro-N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 86968465 |
| Molecular Formula | C17H12Cl3N3O |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 2,3-dichloro-N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]benzamide |
| SMILES | O=C(NCc1cnn(-c2ccc(Cl)cc2)c1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H12Cl3N3O/c18-12-4-6-13(7-5-12)23-10-11(9-22-23)8-21-17(24)14-2-1-3-15(19)16(14)20/h1-7,9-10H,8H2,(H,21,24) |
| InChIKey | BPOUSHHEBZLGLY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |