C19H14ClN3O2 — CID 86968691
N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-benzofuran-2-carboxamide (PubChem CID 86968691) has the molecular formula C19H14ClN3O2 and a molecular weight of 351.79 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 86968691 |
| Molecular Formula | C19H14ClN3O2 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCc1cnn(-c2ccc(Cl)cc2)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H14ClN3O2/c20-15-5-7-16(8-6-15)23-12-13(11-22-23)10-21-19(24)18-9-14-3-1-2-4-17(14)25-18/h1-9,11-12H,10H2,(H,21,24) |
| InChIKey | WOQRJKKIKQELQP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |