C18H15ClFN3OS — CID 86968301
N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-2-(2-fluorophenyl)sulfanylacetamide (PubChem CID 86968301) has the molecular formula C18H15ClFN3OS and a molecular weight of 375.86 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-2-(2-fluorophenyl)sulfanylacetamide.
| Compound Name | N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-2-(2-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 86968301 |
| Molecular Formula | C18H15ClFN3OS |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-2-(2-fluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccccc1F)NCc1cnn(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H15ClFN3OS/c19-14-5-7-15(8-6-14)23-11-13(10-22-23)9-21-18(24)12-25-17-4-2-1-3-16(17)20/h1-8,10-11H,9,12H2,(H,21,24) |
| InChIKey | PGMNYOURHCONSC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |