C15H18ClN3O — CID 43347095
5-chloro-N-[(1-phenylpyrazol-4-yl)methyl]pentanamide (PubChem CID 43347095) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 5-chloro-N-[(1-phenylpyrazol-4-yl)methyl]pentanamide.
| Compound Name | 5-chloro-N-[(1-phenylpyrazol-4-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 43347095 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-chloro-N-[(1-phenylpyrazol-4-yl)methyl]pentanamide |
| SMILES | O=C(CCCCCl)NCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C15H18ClN3O/c16-9-5-4-8-15(20)17-10-13-11-18-19(12-13)14-6-2-1-3-7-14/h1-3,6-7,11-12H,4-5,8-10H2,(H,17,20) |
| InChIKey | KABDRTDGAKVTGB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|