C27H23N7O2 — CID 39058604
2-N,6-N-bis[(1-phenylpyrazol-4-yl)methyl]pyridine-2,6-dicarboxamide (PubChem CID 39058604) has the molecular formula C27H23N7O2 and a molecular weight of 477.53 g/mol. Its IUPAC name is 2-N,6-N-bis[(1-phenylpyrazol-4-yl)methyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[(1-phenylpyrazol-4-yl)methyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 39058604 |
| Molecular Formula | C27H23N7O2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 2-N,6-N-bis[(1-phenylpyrazol-4-yl)methyl]pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCc1cnn(-c2ccccc2)c1)c1cccc(C(=O)NCc2cnn(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C27H23N7O2/c35-26(28-14-20-16-30-33(18-20)22-8-3-1-4-9-22)24-12-7-13-25(32-24)27(36)29-15-21-17-31-34(19-21)23-10-5-2-6-11-23/h1-13,16-19H,14-15H2,(H,28,35)(H,29,36) |
| InChIKey | NACJSWWVNZWZSQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |