C19H16N4O2 — CID 51488523
2-(1,2-benzoxazol-3-yl)-N-[(1-phenylpyrazol-4-yl)methyl]acetamide (PubChem CID 51488523) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-[(1-phenylpyrazol-4-yl)methyl]acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-[(1-phenylpyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 51488523 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-[(1-phenylpyrazol-4-yl)methyl]acetamide |
| SMILES | O=C(Cc1noc2ccccc12)NCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H16N4O2/c24-19(10-17-16-8-4-5-9-18(16)25-22-17)20-11-14-12-21-23(13-14)15-6-2-1-3-7-15/h1-9,12-13H,10-11H2,(H,20,24) |
| InChIKey | ISZAFMJZZHVPOR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |