C21H24N4O — CID 35369573
N-[[4-[(dimethylamino)methyl]phenyl]methyl]-2-(1-phenylpyrazol-4-yl)acetamide (PubChem CID 35369573) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[[4-[(dimethylamino)methyl]phenyl]methyl]-2-(1-phenylpyrazol-4-yl)acetamide.
| Compound Name | N-[[4-[(dimethylamino)methyl]phenyl]methyl]-2-(1-phenylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 35369573 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[[4-[(dimethylamino)methyl]phenyl]methyl]-2-(1-phenylpyrazol-4-yl)acetamide |
| SMILES | CN(C)Cc1ccc(CNC(=O)Cc2cnn(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C21H24N4O/c1-24(2)15-18-10-8-17(9-11-18)13-22-21(26)12-19-14-23-25(16-19)20-6-4-3-5-7-20/h3-11,14,16H,12-13,15H2,1-2H3,(H,22,26) |
| InChIKey | FUYIDQWENXWVDR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |