C21H21N3O4 — CID 51329846
methyl 2-methoxy-5-[[[2-(1-phenylpyrazol-4-yl)acetyl]amino]methyl]benzoate (PubChem CID 51329846) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[[2-(1-phenylpyrazol-4-yl)acetyl]amino]methyl]benzoate.
| Compound Name | methyl 2-methoxy-5-[[[2-(1-phenylpyrazol-4-yl)acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 51329846 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | methyl 2-methoxy-5-[[[2-(1-phenylpyrazol-4-yl)acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)Cc2cnn(-c3ccccc3)c2)ccc1OC |
| InChI | InChI=1S/C21H21N3O4/c1-27-19-9-8-15(10-18(19)21(26)28-2)12-22-20(25)11-16-13-23-24(14-16)17-6-4-3-5-7-17/h3-10,13-14H,11-12H2,1-2H3,(H,22,25) |
| InChIKey | MOWSWGXRNNQJQX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |