C26H24N4O4 — CID 16614506
N-[2,5-dimethoxy-4-[[2-(1-phenylpyrazol-4-yl)acetyl]amino]phenyl]benzamide (PubChem CID 16614506) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-[[2-(1-phenylpyrazol-4-yl)acetyl]amino]phenyl]benzamide.
| Compound Name | N-[2,5-dimethoxy-4-[[2-(1-phenylpyrazol-4-yl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 16614506 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[2,5-dimethoxy-4-[[2-(1-phenylpyrazol-4-yl)acetyl]amino]phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N4O4/c1-33-23-15-22(29-26(32)19-9-5-3-6-10-19)24(34-2)14-21(23)28-25(31)13-18-16-27-30(17-18)20-11-7-4-8-12-20/h3-12,14-17H,13H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | WYPFFQIFHDIOHD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |