C21H22N4O5 — CID 78839667
N-(4,5-diethoxy-2-nitrophenyl)-2-(1-phenylpyrazol-4-yl)acetamide (PubChem CID 78839667) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-(4,5-diethoxy-2-nitrophenyl)-2-(1-phenylpyrazol-4-yl)acetamide.
| Compound Name | N-(4,5-diethoxy-2-nitrophenyl)-2-(1-phenylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 78839667 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-(4,5-diethoxy-2-nitrophenyl)-2-(1-phenylpyrazol-4-yl)acetamide |
| SMILES | CCOc1cc(NC(=O)Cc2cnn(-c3ccccc3)c2)c([N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C21H22N4O5/c1-3-29-19-11-17(18(25(27)28)12-20(19)30-4-2)23-21(26)10-15-13-22-24(14-15)16-8-6-5-7-9-16/h5-9,11-14H,3-4,10H2,1-2H3,(H,23,26) |
| InChIKey | QJNLDNLGGZGBPB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|