C17H21N3O6 — CID 86912998
N-(4,5-diethoxy-2-nitrophenyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide (PubChem CID 86912998) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is N-(4,5-diethoxy-2-nitrophenyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide.
| Compound Name | N-(4,5-diethoxy-2-nitrophenyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 86912998 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-(4,5-diethoxy-2-nitrophenyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide |
| SMILES | CCOc1cc(NC(=O)Cc2c(C)noc2C)c([N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C17H21N3O6/c1-5-24-15-8-13(14(20(22)23)9-16(15)25-6-2)18-17(21)7-12-10(3)19-26-11(12)4/h8-9H,5-7H2,1-4H3,(H,18,21) |
| InChIKey | DXSUXGWGPUIZKG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|