C10H15N3O4 — CID 60920771
(4,5-diethoxy-2-nitrophenyl)hydrazine (PubChem CID 60920771) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is (4,5-diethoxy-2-nitrophenyl)hydrazine.
| Compound Name | (4,5-diethoxy-2-nitrophenyl)hydrazine |
|---|---|
| PubChem CID | 60920771 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (4,5-diethoxy-2-nitrophenyl)hydrazine |
| SMILES | CCOc1cc(NN)c([N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C10H15N3O4/c1-3-16-9-5-7(12-11)8(13(14)15)6-10(9)17-4-2/h5-6,12H,3-4,11H2,1-2H3 |
| InChIKey | ANEXFUMZFFELAH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|