C12H8F7N3O6 — CID 14577516
N-(5-ethoxy-2,4-dinitrophenyl)-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide (PubChem CID 14577516) has the molecular formula C12H8F7N3O6 and a molecular weight of 423.20 g/mol. Its IUPAC name is N-(5-ethoxy-2,4-dinitrophenyl)-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-(5-ethoxy-2,4-dinitrophenyl)-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 14577516 |
| Molecular Formula | C12H8F7N3O6 |
| Molecular Weight | 423.20 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | N-(5-ethoxy-2,4-dinitrophenyl)-2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanamide |
| SMILES | CCOc1cc(NC(=O)C(F)(C(F)(F)F)C(F)(F)F)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8F7N3O6/c1-2-28-8-3-5(6(21(24)25)4-7(8)22(26)27)20-9(23)10(13,11(14,15)16)12(17,18)19/h3-4H,2H2,1H3,(H,20,23) |
| InChIKey | QJMFUPRLGCSIHK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|