C10H9F3N2O5 — CID 110443180
N-(4,5-dimethoxy-2-nitrophenyl)-2,2,2-trifluoroacetamide (PubChem CID 110443180) has the molecular formula C10H9F3N2O5 and a molecular weight of 294.19 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-nitrophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4,5-dimethoxy-2-nitrophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 110443180 |
| Molecular Formula | C10H9F3N2O5 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | N-(4,5-dimethoxy-2-nitrophenyl)-2,2,2-trifluoroacetamide |
| SMILES | COc1cc(NC(=O)C(F)(F)F)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C10H9F3N2O5/c1-19-7-3-5(14-9(16)10(11,12)13)6(15(17)18)4-8(7)20-2/h3-4H,1-2H3,(H,14,16) |
| InChIKey | XZXALHHSRCOPJC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|