C15H15N3O5 — CID 110446745
1-(4,5-dimethoxy-2-nitrophenyl)-3-phenylurea (PubChem CID 110446745) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrophenyl)-3-phenylurea.
| Compound Name | 1-(4,5-dimethoxy-2-nitrophenyl)-3-phenylurea |
|---|---|
| PubChem CID | 110446745 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)-3-phenylurea |
| SMILES | COc1cc(NC(=O)Nc2ccccc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H15N3O5/c1-22-13-8-11(12(18(20)21)9-14(13)23-2)17-15(19)16-10-6-4-3-5-7-10/h3-9H,1-2H3,(H2,16,17,19) |
| InChIKey | ICIAPRUEVPRFTN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|