C21H19N3O5 — CID 27537881
4-anilino-N-(3,4-dimethoxyphenyl)-3-nitrobenzamide (PubChem CID 27537881) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 4-anilino-N-(3,4-dimethoxyphenyl)-3-nitrobenzamide.
| Compound Name | 4-anilino-N-(3,4-dimethoxyphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 27537881 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-anilino-N-(3,4-dimethoxyphenyl)-3-nitrobenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Nc3ccccc3)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C21H19N3O5/c1-28-19-11-9-16(13-20(19)29-2)23-21(25)14-8-10-17(18(12-14)24(26)27)22-15-6-4-3-5-7-15/h3-13,22H,1-2H3,(H,23,25) |
| InChIKey | HJWLYCXVXKQTII-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|