C21H18ClN3O5 — CID 24570934
4-anilino-N-(5-chloro-2,4-dimethoxyphenyl)-3-nitrobenzamide (PubChem CID 24570934) has the molecular formula C21H18ClN3O5 and a molecular weight of 427.84 g/mol. Its IUPAC name is 4-anilino-N-(5-chloro-2,4-dimethoxyphenyl)-3-nitrobenzamide.
| Compound Name | 4-anilino-N-(5-chloro-2,4-dimethoxyphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 24570934 |
| Molecular Formula | C21H18ClN3O5 |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 4-anilino-N-(5-chloro-2,4-dimethoxyphenyl)-3-nitrobenzamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(Nc3ccccc3)c([N+](=O)[O-])c2)cc1Cl |
| InChI | InChI=1S/C21H18ClN3O5/c1-29-19-12-20(30-2)17(11-15(19)22)24-21(26)13-8-9-16(18(10-13)25(27)28)23-14-6-4-3-5-7-14/h3-12,23H,1-2H3,(H,24,26) |
| InChIKey | YUQUXEMOCHHGIR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|