C24H24N4O6 — CID 46551142
4-anilino-N'-(3-methoxy-4-propan-2-yloxybenzoyl)-3-nitrobenzohydrazide (PubChem CID 46551142) has the molecular formula C24H24N4O6 and a molecular weight of 464.48 g/mol. Its IUPAC name is 4-anilino-N'-(3-methoxy-4-propan-2-yloxybenzoyl)-3-nitrobenzohydrazide.
| Compound Name | 4-anilino-N'-(3-methoxy-4-propan-2-yloxybenzoyl)-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 46551142 |
| Molecular Formula | C24H24N4O6 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 4-anilino-N'-(3-methoxy-4-propan-2-yloxybenzoyl)-3-nitrobenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccc(Nc3ccccc3)c([N+](=O)[O-])c2)ccc1OC(C)C |
| InChI | InChI=1S/C24H24N4O6/c1-15(2)34-21-12-10-17(14-22(21)33-3)24(30)27-26-23(29)16-9-11-19(20(13-16)28(31)32)25-18-7-5-4-6-8-18/h4-15,25H,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | XOHTVKWKUHAVGK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|