C25H26N2O4 — CID 7972036
N'-(2,2-diphenylacetyl)-3-methoxy-4-propan-2-yloxybenzohydrazide (PubChem CID 7972036) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N'-(2,2-diphenylacetyl)-3-methoxy-4-propan-2-yloxybenzohydrazide.
| Compound Name | N'-(2,2-diphenylacetyl)-3-methoxy-4-propan-2-yloxybenzohydrazide |
|---|---|
| PubChem CID | 7972036 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N'-(2,2-diphenylacetyl)-3-methoxy-4-propan-2-yloxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)C(c2ccccc2)c2ccccc2)ccc1OC(C)C |
| InChI | InChI=1S/C25H26N2O4/c1-17(2)31-21-15-14-20(16-22(21)30-3)24(28)26-27-25(29)23(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-17,23H,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | GEFJCTSILWMLDK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|