C19H22N2O4S — CID 8621899
3-methoxy-N'-(4-methylsulfanylbenzoyl)-4-propan-2-yloxybenzohydrazide (PubChem CID 8621899) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 3-methoxy-N'-(4-methylsulfanylbenzoyl)-4-propan-2-yloxybenzohydrazide.
| Compound Name | 3-methoxy-N'-(4-methylsulfanylbenzoyl)-4-propan-2-yloxybenzohydrazide |
|---|---|
| PubChem CID | 8621899 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 3-methoxy-N'-(4-methylsulfanylbenzoyl)-4-propan-2-yloxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccc(SC)cc2)ccc1OC(C)C |
| InChI | InChI=1S/C19H22N2O4S/c1-12(2)25-16-10-7-14(11-17(16)24-3)19(23)21-20-18(22)13-5-8-15(26-4)9-6-13/h5-12H,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | NOCRMABLZKVASO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|