C19H20F2N2O5 — CID 26655758
N'-[4-(difluoromethoxy)benzoyl]-3-methoxy-4-propan-2-yloxybenzohydrazide (PubChem CID 26655758) has the molecular formula C19H20F2N2O5 and a molecular weight of 394.37 g/mol. Its IUPAC name is N'-[4-(difluoromethoxy)benzoyl]-3-methoxy-4-propan-2-yloxybenzohydrazide.
| Compound Name | N'-[4-(difluoromethoxy)benzoyl]-3-methoxy-4-propan-2-yloxybenzohydrazide |
|---|---|
| PubChem CID | 26655758 |
| Molecular Formula | C19H20F2N2O5 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N'-[4-(difluoromethoxy)benzoyl]-3-methoxy-4-propan-2-yloxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccc(OC(F)F)cc2)ccc1OC(C)C |
| InChI | InChI=1S/C19H20F2N2O5/c1-11(2)27-15-9-6-13(10-16(15)26-3)18(25)23-22-17(24)12-4-7-14(8-5-12)28-19(20)21/h4-11,19H,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | FZFLAGSLEDAPCX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|