C18H18F2N2O4 — CID 2435971
N'-[1-[4-(difluoromethoxy)phenyl]ethenyl]-3,4-dimethoxybenzohydrazide (PubChem CID 2435971) has the molecular formula C18H18F2N2O4 and a molecular weight of 364.35 g/mol. Its IUPAC name is N'-[1-[4-(difluoromethoxy)phenyl]ethenyl]-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-[1-[4-(difluoromethoxy)phenyl]ethenyl]-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 2435971 |
| Molecular Formula | C18H18F2N2O4 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N'-[1-[4-(difluoromethoxy)phenyl]ethenyl]-3,4-dimethoxybenzohydrazide |
| SMILES | C=C(NNC(=O)c1ccc(OC)c(OC)c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H18F2N2O4/c1-11(12-4-7-14(8-5-12)26-18(19)20)21-22-17(23)13-6-9-15(24-2)16(10-13)25-3/h4-10,18,21H,1H2,2-3H3,(H,22,23) |
| InChIKey | ACIJCRDTZWSGIU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|