C18H17N3O3 — CID 2453941
N'-[1-(4-cyanophenyl)ethenyl]-3,4-dimethoxybenzohydrazide (PubChem CID 2453941) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is N'-[1-(4-cyanophenyl)ethenyl]-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-[1-(4-cyanophenyl)ethenyl]-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 2453941 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N'-[1-(4-cyanophenyl)ethenyl]-3,4-dimethoxybenzohydrazide |
| SMILES | C=C(NNC(=O)c1ccc(OC)c(OC)c1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-12(14-6-4-13(11-19)5-7-14)20-21-18(22)15-8-9-16(23-2)17(10-15)24-3/h4-10,20H,1H2,2-3H3,(H,21,22) |
| InChIKey | MEWYSMWGYKQDGW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|