C15H20N2O3 — CID 61119027
N-(3-cyanopentan-3-yl)-3,4-dimethoxybenzamide (PubChem CID 61119027) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(3-cyanopentan-3-yl)-3,4-dimethoxybenzamide.
| Compound Name | N-(3-cyanopentan-3-yl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 61119027 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-(3-cyanopentan-3-yl)-3,4-dimethoxybenzamide |
| SMILES | CCC(C#N)(CC)NC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H20N2O3/c1-5-15(6-2,10-16)17-14(18)11-7-8-12(19-3)13(9-11)20-4/h7-9H,5-6H2,1-4H3,(H,17,18) |
| InChIKey | RLUPISCFQAVJKS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |