C13H16N2O4 — CID 131860566
N-[cyano(ethoxy)methyl]-3,4-dimethoxybenzamide (PubChem CID 131860566) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is N-[cyano(ethoxy)methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[cyano(ethoxy)methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 131860566 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-[cyano(ethoxy)methyl]-3,4-dimethoxybenzamide |
| SMILES | CCOC(C#N)NC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H16N2O4/c1-4-19-12(8-14)15-13(16)9-5-6-10(17-2)11(7-9)18-3/h5-7,12H,4H2,1-3H3,(H,15,16) |
| InChIKey | TYGZQEJLCPCNMM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|