C19H23NO4 — CID 30035134
N-[(1S)-1-(4-ethoxyphenyl)ethyl]-3,4-dimethoxybenzamide (PubChem CID 30035134) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[(1S)-1-(4-ethoxyphenyl)ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(1S)-1-(4-ethoxyphenyl)ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 30035134 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[(1S)-1-(4-ethoxyphenyl)ethyl]-3,4-dimethoxybenzamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H23NO4/c1-5-24-16-9-6-14(7-10-16)13(2)20-19(21)15-8-11-17(22-3)18(12-15)23-4/h6-13H,5H2,1-4H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | XHSSJNBRZJQZAK-ZDUSSCGKSA-N |
| XLogP | 3.59 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |