C19H21NO4 — CID 51292630
methyl 4-[1-(4-ethoxyphenyl)ethylcarbamoyl]benzoate (PubChem CID 51292630) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl 4-[1-(4-ethoxyphenyl)ethylcarbamoyl]benzoate.
| Compound Name | methyl 4-[1-(4-ethoxyphenyl)ethylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 51292630 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | methyl 4-[1-(4-ethoxyphenyl)ethylcarbamoyl]benzoate |
| SMILES | CCOc1ccc(C(C)NC(=O)c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C19H21NO4/c1-4-24-17-11-9-14(10-12-17)13(2)20-18(21)15-5-7-16(8-6-15)19(22)23-3/h5-13H,4H2,1-3H3,(H,20,21) |
| InChIKey | UAWOWQXCAGTCNU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |