C23H31NO5 — CID 55747285
3,4-dimethoxy-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]benzamide (PubChem CID 55747285) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55747285 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 3,4-dimethoxy-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]benzamide |
| SMILES | CCCCCOc1ccc(C(C)NC(=O)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C23H31NO5/c1-6-7-8-13-29-20-12-9-17(14-22(20)28-5)16(2)24-23(25)18-10-11-19(26-3)21(15-18)27-4/h9-12,14-16H,6-8,13H2,1-5H3,(H,24,25) |
| InChIKey | SIEDUGDEORSNSO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|