C31H36Cl2N2O4 — CID 18839362
4-chloro-N-[[(4-chlorobenzoyl)amino]-(3-methoxy-4-nonoxyphenyl)methyl]benzamide (PubChem CID 18839362) has the molecular formula C31H36Cl2N2O4 and a molecular weight of 571.55 g/mol. Its IUPAC name is 4-chloro-N-[[(4-chlorobenzoyl)amino]-(3-methoxy-4-nonoxyphenyl)methyl]benzamide.
| Compound Name | 4-chloro-N-[[(4-chlorobenzoyl)amino]-(3-methoxy-4-nonoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 18839362 |
| Molecular Formula | C31H36Cl2N2O4 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 4-chloro-N-[[(4-chlorobenzoyl)amino]-(3-methoxy-4-nonoxyphenyl)methyl]benzamide |
| SMILES | CCCCCCCCCOc1ccc(C(NC(=O)c2ccc(Cl)cc2)NC(=O)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C31H36Cl2N2O4/c1-3-4-5-6-7-8-9-20-39-27-19-14-24(21-28(27)38-2)29(34-30(36)22-10-15-25(32)16-11-22)35-31(37)23-12-17-26(33)18-13-23/h10-19,21,29H,3-9,20H2,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | CWIJUFKBURNXFD-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|