C29H32N4O8 — CID 5209334
N-[(4-heptoxy-3-methoxyphenyl)-[(4-nitrobenzoyl)amino]methyl]-4-nitrobenzamide (PubChem CID 5209334) has the molecular formula C29H32N4O8 and a molecular weight of 564.60 g/mol. Its IUPAC name is N-[(4-heptoxy-3-methoxyphenyl)-[(4-nitrobenzoyl)amino]methyl]-4-nitrobenzamide.
| Compound Name | N-[(4-heptoxy-3-methoxyphenyl)-[(4-nitrobenzoyl)amino]methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 5209334 |
| Molecular Formula | C29H32N4O8 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | N-[(4-heptoxy-3-methoxyphenyl)-[(4-nitrobenzoyl)amino]methyl]-4-nitrobenzamide |
| SMILES | CCCCCCCOc1ccc(C(NC(=O)c2ccc([N+](=O)[O-])cc2)NC(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C29H32N4O8/c1-3-4-5-6-7-18-41-25-17-12-22(19-26(25)40-2)27(30-28(34)20-8-13-23(14-9-20)32(36)37)31-29(35)21-10-15-24(16-11-21)33(38)39/h8-17,19,27H,3-7,18H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | RMYSGIUILOTDLH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|