C33H42N2O4 — CID 18839441
4-tert-butyl-N-[[(4-tert-butylbenzoyl)amino]-(3-methoxy-4-propoxyphenyl)methyl]benzamide (PubChem CID 18839441) has the molecular formula C33H42N2O4 and a molecular weight of 530.71 g/mol. Its IUPAC name is 4-tert-butyl-N-[[(4-tert-butylbenzoyl)amino]-(3-methoxy-4-propoxyphenyl)methyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[(4-tert-butylbenzoyl)amino]-(3-methoxy-4-propoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 18839441 |
| Molecular Formula | C33H42N2O4 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | 4-tert-butyl-N-[[(4-tert-butylbenzoyl)amino]-(3-methoxy-4-propoxyphenyl)methyl]benzamide |
| SMILES | CCCOc1ccc(C(NC(=O)c2ccc(C(C)(C)C)cc2)NC(=O)c2ccc(C(C)(C)C)cc2)cc1OC |
| InChI | InChI=1S/C33H42N2O4/c1-9-20-39-27-19-14-24(21-28(27)38-8)29(34-30(36)22-10-15-25(16-11-22)32(2,3)4)35-31(37)23-12-17-26(18-13-23)33(5,6)7/h10-19,21,29H,9,20H2,1-8H3,(H,34,36)(H,35,37) |
| InChIKey | AJPMIWJMGXWSBH-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|