C37H42N2O4 — CID 18890174
4-tert-butyl-N-[[(4-tert-butylbenzoyl)amino]-(4-methoxy-3-phenylmethoxyphenyl)methyl]benzamide (PubChem CID 18890174) has the molecular formula C37H42N2O4 and a molecular weight of 578.75 g/mol. Its IUPAC name is 4-tert-butyl-N-[[(4-tert-butylbenzoyl)amino]-(4-methoxy-3-phenylmethoxyphenyl)methyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[(4-tert-butylbenzoyl)amino]-(4-methoxy-3-phenylmethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 18890174 |
| Molecular Formula | C37H42N2O4 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | 4-tert-butyl-N-[[(4-tert-butylbenzoyl)amino]-(4-methoxy-3-phenylmethoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(C(NC(=O)c2ccc(C(C)(C)C)cc2)NC(=O)c2ccc(C(C)(C)C)cc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C37H42N2O4/c1-36(2,3)29-18-13-26(14-19-29)34(40)38-33(39-35(41)27-15-20-30(21-16-27)37(4,5)6)28-17-22-31(42-7)32(23-28)43-24-25-11-9-8-10-12-25/h8-23,33H,24H2,1-7H3,(H,38,40)(H,39,41) |
| InChIKey | BNXKLLVVXZXSJW-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|