C21H27NO5 — CID 11428749
tert-butyl N-[(1R)-2-hydroxy-1-(4-methoxy-3-phenylmethoxyphenyl)ethyl]carbamate (PubChem CID 11428749) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-hydroxy-1-(4-methoxy-3-phenylmethoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-hydroxy-1-(4-methoxy-3-phenylmethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 11428749 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | tert-butyl N-[(1R)-2-hydroxy-1-(4-methoxy-3-phenylmethoxyphenyl)ethyl]carbamate |
| SMILES | COc1ccc([C@H](CO)NC(=O)OC(C)(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO5/c1-21(2,3)27-20(24)22-17(13-23)16-10-11-18(25-4)19(12-16)26-14-15-8-6-5-7-9-15/h5-12,17,23H,13-14H2,1-4H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | HZAUGQCQTSKEQB-KRWDZBQOSA-N |
| XLogP | 3.83 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |