C24H31NO6 — CID 123615845
tert-butyl N-[2-formyl-1-methoxy-3-(4-methoxy-3-phenylmethoxyphenyl)propan-2-yl]carbamate (PubChem CID 123615845) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is tert-butyl N-[2-formyl-1-methoxy-3-(4-methoxy-3-phenylmethoxyphenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-formyl-1-methoxy-3-(4-methoxy-3-phenylmethoxyphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 123615845 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | tert-butyl N-[2-formyl-1-methoxy-3-(4-methoxy-3-phenylmethoxyphenyl)propan-2-yl]carbamate |
| SMILES | COCC(C=O)(Cc1ccc(OC)c(OCc2ccccc2)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31NO6/c1-23(2,3)31-22(27)25-24(16-26,17-28-4)14-19-11-12-20(29-5)21(13-19)30-15-18-9-7-6-8-10-18/h6-13,16H,14-15,17H2,1-5H3,(H,25,27) |
| InChIKey | HBWGPPCMWJXPOF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|