C31H45NO7 — CID 22865836
(2R,4S,5S,7S)-4-hydroxy-7-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid (PubChem CID 22865836) has the molecular formula C31H45NO7 and a molecular weight of 543.70 g/mol. Its IUPAC name is (2R,4S,5S,7S)-4-hydroxy-7-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid.
| Compound Name | (2R,4S,5S,7S)-4-hydroxy-7-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
|---|---|
| PubChem CID | 22865836 |
| Molecular Formula | C31H45NO7 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | (2R,4S,5S,7S)-4-hydroxy-7-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
| SMILES | COc1ccc(C[C@@H](C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)C[C@@H](C)C(=O)O)C(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C31H45NO7/c1-20(2)24(18-25(26(33)15-21(3)29(34)35)32-30(36)39-31(4,5)6)16-23-13-14-27(37-7)28(17-23)38-19-22-11-9-8-10-12-22/h8-14,17,20-21,24-26,33H,15-16,18-19H2,1-7H3,(H,32,36)(H,34,35)/t21-,24+,25+,26+/m1/s1 |
| InChIKey | ZZBTVVKMUTUSHL-NDEVUPSOSA-N |
| XLogP | 5.84 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |