C32H55N3O8 — CID 54299838
tert-butyl N-[(2R,4S,5S,7S)-1-[(4-amino-4-oxobutyl)amino]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-1-oxononan-5-yl]carbamate (PubChem CID 54299838) has the molecular formula C32H55N3O8 and a molecular weight of 609.81 g/mol. Its IUPAC name is tert-butyl N-[(2R,4S,5S,7S)-1-[(4-amino-4-oxobutyl)amino]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-1-oxononan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,4S,5S,7S)-1-[(4-amino-4-oxobutyl)amino]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-1-oxononan-5-yl]carbamate |
|---|---|
| PubChem CID | 54299838 |
| Molecular Formula | C32H55N3O8 |
| Molecular Weight | 609.81 g/mol |
| Exact Mass | 609.40 |
| IUPAC Name | tert-butyl N-[(2R,4S,5S,7S)-1-[(4-amino-4-oxobutyl)amino]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-1-oxononan-5-yl]carbamate |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)C[C@@H](C)C(=O)NCCCC(N)=O)C(C)C)ccc1OC |
| InChI | InChI=1S/C32H55N3O8/c1-21(2)24(18-23-12-13-27(41-8)28(19-23)42-16-10-15-40-7)20-25(35-31(39)43-32(4,5)6)26(36)17-22(3)30(38)34-14-9-11-29(33)37/h12-13,19,21-22,24-26,36H,9-11,14-18,20H2,1-8H3,(H2,33,37)(H,34,38)(H,35,39)/t22-,24+,25+,26+/m1/s1 |
| InChIKey | SDKNBNPRYJSZIL-DNZIZEQUSA-N |
| XLogP | 3.98 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|