C29H49NO9 — CID 22865827
(2R,4S,5S,7S)-4-hydroxy-7-[[4-methoxy-3-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl]-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid (PubChem CID 22865827) has the molecular formula C29H49NO9 and a molecular weight of 555.71 g/mol. Its IUPAC name is (2R,4S,5S,7S)-4-hydroxy-7-[[4-methoxy-3-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl]-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid.
| Compound Name | (2R,4S,5S,7S)-4-hydroxy-7-[[4-methoxy-3-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl]-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
|---|---|
| PubChem CID | 22865827 |
| Molecular Formula | C29H49NO9 |
| Molecular Weight | 555.71 g/mol |
| Exact Mass | 555.34 |
| IUPAC Name | (2R,4S,5S,7S)-4-hydroxy-7-[[4-methoxy-3-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl]-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
| SMILES | COCCOCCOc1cc(C[C@@H](C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)C[C@@H](C)C(=O)O)C(C)C)ccc1OC |
| InChI | InChI=1S/C29H49NO9/c1-19(2)22(16-21-9-10-25(36-8)26(17-21)38-14-13-37-12-11-35-7)18-23(24(31)15-20(3)27(32)33)30-28(34)39-29(4,5)6/h9-10,17,19-20,22-24,31H,11-16,18H2,1-8H3,(H,30,34)(H,32,33)/t20-,22+,23+,24+/m1/s1 |
| InChIKey | VPYLHDBJHLZOQJ-KAMZKSLDSA-N |
| XLogP | 4.31 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|