C37H58N2O7 — CID 67089692
tert-butyl N-[(3R,5S,6R,8S)-8-(benzylcarbamoyl)-6-hydroxy-3-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl]carbamate (PubChem CID 67089692) has the molecular formula C37H58N2O7 and a molecular weight of 642.88 g/mol. Its IUPAC name is tert-butyl N-[(3R,5S,6R,8S)-8-(benzylcarbamoyl)-6-hydroxy-3-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,5S,6R,8S)-8-(benzylcarbamoyl)-6-hydroxy-3-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl]carbamate |
|---|---|
| PubChem CID | 67089692 |
| Molecular Formula | C37H58N2O7 |
| Molecular Weight | 642.88 g/mol |
| Exact Mass | 642.42 |
| IUPAC Name | tert-butyl N-[(3R,5S,6R,8S)-8-(benzylcarbamoyl)-6-hydroxy-3-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl]carbamate |
| SMILES | COCCCOc1cc(C[C@H](C[C@H](NC(=O)OC(C)(C)C)[C@H](O)C[C@H](C(=O)NCc2ccccc2)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C37H58N2O7/c1-25(2)29(20-28-16-17-33(44-9)34(21-28)45-19-13-18-43-8)22-31(39-36(42)46-37(5,6)7)32(40)23-30(26(3)4)35(41)38-24-27-14-11-10-12-15-27/h10-12,14-17,21,25-26,29-32,40H,13,18-20,22-24H2,1-9H3,(H,38,41)(H,39,42)/t29-,30+,31+,32-/m1/s1 |
| InChIKey | WEORHVFYSCVICQ-OKDNLZPVSA-N |
| XLogP | 6.55 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.88 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|