C33H55NO10 — CID 22865810
(2R,4S,5S,7S)-7-[[4-(4-ethoxy-4-oxobutoxy)-3-(3-methoxypropoxy)phenyl]methyl]-4-hydroxy-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid (PubChem CID 22865810) has the molecular formula C33H55NO10 and a molecular weight of 625.80 g/mol. Its IUPAC name is (2R,4S,5S,7S)-7-[[4-(4-ethoxy-4-oxobutoxy)-3-(3-methoxypropoxy)phenyl]methyl]-4-hydroxy-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid.
| Compound Name | (2R,4S,5S,7S)-7-[[4-(4-ethoxy-4-oxobutoxy)-3-(3-methoxypropoxy)phenyl]methyl]-4-hydroxy-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
|---|---|
| PubChem CID | 22865810 |
| Molecular Formula | C33H55NO10 |
| Molecular Weight | 625.80 g/mol |
| Exact Mass | 625.38 |
| IUPAC Name | (2R,4S,5S,7S)-7-[[4-(4-ethoxy-4-oxobutoxy)-3-(3-methoxypropoxy)phenyl]methyl]-4-hydroxy-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
| SMILES | CCOC(=O)CCCOc1ccc(C[C@@H](C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)C[C@@H](C)C(=O)O)C(C)C)cc1OCCCOC |
| InChI | InChI=1S/C33H55NO10/c1-9-41-30(36)12-10-16-42-28-14-13-24(20-29(28)43-17-11-15-40-8)19-25(22(2)3)21-26(27(35)18-23(4)31(37)38)34-32(39)44-33(5,6)7/h13-14,20,22-23,25-27,35H,9-12,15-19,21H2,1-8H3,(H,34,39)(H,37,38)/t23-,25+,26+,27+/m1/s1 |
| InChIKey | IXKFLXZOPRLPIZ-BDGPUAICSA-N |
| XLogP | 5.39 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.80 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|