C35H63N3O7 — CID 54407826
tert-butyl N-[(2R,4S,5S,7S)-7-[[4-(4-aminobutoxy)-3-(3-methoxypropoxy)phenyl]methyl]-1-(butylamino)-4-hydroxy-2,8-dimethyl-1-oxononan-5-yl]carbamate (PubChem CID 54407826) has the molecular formula C35H63N3O7 and a molecular weight of 637.90 g/mol. Its IUPAC name is tert-butyl N-[(2R,4S,5S,7S)-7-[[4-(4-aminobutoxy)-3-(3-methoxypropoxy)phenyl]methyl]-1-(butylamino)-4-hydroxy-2,8-dimethyl-1-oxononan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,4S,5S,7S)-7-[[4-(4-aminobutoxy)-3-(3-methoxypropoxy)phenyl]methyl]-1-(butylamino)-4-hydroxy-2,8-dimethyl-1-oxononan-5-yl]carbamate |
|---|---|
| PubChem CID | 54407826 |
| Molecular Formula | C35H63N3O7 |
| Molecular Weight | 637.90 g/mol |
| Exact Mass | 637.47 |
| IUPAC Name | tert-butyl N-[(2R,4S,5S,7S)-7-[[4-(4-aminobutoxy)-3-(3-methoxypropoxy)phenyl]methyl]-1-(butylamino)-4-hydroxy-2,8-dimethyl-1-oxononan-5-yl]carbamate |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](C[C@H](Cc1ccc(OCCCCN)c(OCCCOC)c1)C(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H63N3O7/c1-9-10-17-37-33(40)26(4)21-30(39)29(38-34(41)45-35(5,6)7)24-28(25(2)3)22-27-14-15-31(43-19-12-11-16-36)32(23-27)44-20-13-18-42-8/h14-15,23,25-26,28-30,39H,9-13,16-22,24,36H2,1-8H3,(H,37,40)(H,38,41)/t26-,28+,29+,30+/m1/s1 |
| InChIKey | VRZKHCFHZATHBN-ZRJFKUPHSA-N |
| XLogP | 5.62 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.90 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|