C27H45NO6 — CID 22865841
(2R,4S,5S,7S)-7-[(4-tert-butyl-3-hydroxyphenyl)methyl]-4-hydroxy-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid (PubChem CID 22865841) has the molecular formula C27H45NO6 and a molecular weight of 479.66 g/mol. Its IUPAC name is (2R,4S,5S,7S)-7-[(4-tert-butyl-3-hydroxyphenyl)methyl]-4-hydroxy-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid.
| Compound Name | (2R,4S,5S,7S)-7-[(4-tert-butyl-3-hydroxyphenyl)methyl]-4-hydroxy-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
|---|---|
| PubChem CID | 22865841 |
| Molecular Formula | C27H45NO6 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | (2R,4S,5S,7S)-7-[(4-tert-butyl-3-hydroxyphenyl)methyl]-4-hydroxy-2,8-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
| SMILES | CC(C)[C@@H](Cc1ccc(C(C)(C)C)c(O)c1)C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)C[C@@H](C)C(=O)O |
| InChI | InChI=1S/C27H45NO6/c1-16(2)19(13-18-10-11-20(22(29)14-18)26(4,5)6)15-21(23(30)12-17(3)24(31)32)28-25(33)34-27(7,8)9/h10-11,14,16-17,19,21,23,29-30H,12-13,15H2,1-9H3,(H,28,33)(H,31,32)/t17-,19+,21+,23+/m1/s1 |
| InChIKey | WVRRAYIKZYWCRK-FAHLNCGFSA-N |
| XLogP | 5.26 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |