C31H54N2O5 — CID 142658400
tert-butyl N-[(2R,4S,5S,7S)-1-(butylamino)-7-[(4-tert-butyl-2-hydroxyphenyl)methyl]-4-hydroxy-2,8-dimethyl-1-oxononan-5-yl]carbamate (PubChem CID 142658400) has the molecular formula C31H54N2O5 and a molecular weight of 534.78 g/mol. Its IUPAC name is tert-butyl N-[(2R,4S,5S,7S)-1-(butylamino)-7-[(4-tert-butyl-2-hydroxyphenyl)methyl]-4-hydroxy-2,8-dimethyl-1-oxononan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,4S,5S,7S)-1-(butylamino)-7-[(4-tert-butyl-2-hydroxyphenyl)methyl]-4-hydroxy-2,8-dimethyl-1-oxononan-5-yl]carbamate |
|---|---|
| PubChem CID | 142658400 |
| Molecular Formula | C31H54N2O5 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.40 |
| IUPAC Name | tert-butyl N-[(2R,4S,5S,7S)-1-(butylamino)-7-[(4-tert-butyl-2-hydroxyphenyl)methyl]-4-hydroxy-2,8-dimethyl-1-oxononan-5-yl]carbamate |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](C[C@H](Cc1ccc(C(C)(C)C)cc1O)C(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H54N2O5/c1-11-12-15-32-28(36)21(4)16-27(35)25(33-29(37)38-31(8,9)10)18-23(20(2)3)17-22-13-14-24(19-26(22)34)30(5,6)7/h13-14,19-21,23,25,27,34-35H,11-12,15-18H2,1-10H3,(H,32,36)(H,33,37)/t21-,23+,25+,27+/m1/s1 |
| InChIKey | FBUSTCMHJBDJGF-FXAKWJDQSA-N |
| XLogP | 6.09 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|