C35H51N5O6 — CID 67752402
tert-butyl N-[(2R,4S,5S,7R)-1-(butylamino)-4-hydroxy-2,8-dimethyl-1-oxo-7-[[(1-pyridin-2-ylindol-3-yl)oxycarbonylamino]methyl]nonan-5-yl]carbamate (PubChem CID 67752402) has the molecular formula C35H51N5O6 and a molecular weight of 637.82 g/mol. Its IUPAC name is tert-butyl N-[(2R,4S,5S,7R)-1-(butylamino)-4-hydroxy-2,8-dimethyl-1-oxo-7-[[(1-pyridin-2-ylindol-3-yl)oxycarbonylamino]methyl]nonan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,4S,5S,7R)-1-(butylamino)-4-hydroxy-2,8-dimethyl-1-oxo-7-[[(1-pyridin-2-ylindol-3-yl)oxycarbonylamino]methyl]nonan-5-yl]carbamate |
|---|---|
| PubChem CID | 67752402 |
| Molecular Formula | C35H51N5O6 |
| Molecular Weight | 637.82 g/mol |
| Exact Mass | 637.38 |
| IUPAC Name | tert-butyl N-[(2R,4S,5S,7R)-1-(butylamino)-4-hydroxy-2,8-dimethyl-1-oxo-7-[[(1-pyridin-2-ylindol-3-yl)oxycarbonylamino]methyl]nonan-5-yl]carbamate |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](C[C@@H](CNC(=O)Oc1cn(-c2ccccn2)c2ccccc12)C(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H51N5O6/c1-8-9-17-37-32(42)24(4)19-29(41)27(39-34(44)46-35(5,6)7)20-25(23(2)3)21-38-33(43)45-30-22-40(31-16-12-13-18-36-31)28-15-11-10-14-26(28)30/h10-16,18,22-25,27,29,41H,8-9,17,19-21H2,1-7H3,(H,37,42)(H,38,43)(H,39,44)/t24-,25+,27+,29+/m1/s1 |
| InChIKey | YYWYXNPZEJFJHX-XYCBIXARSA-N |
| XLogP | 5.97 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.82 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|