C36H63N5O9 — CID 67752843
tert-butyl N-[(3S,5S,6S,8S)-6-hydroxy-3-[[[3-(4-methoxybutoxy)-2-pyridinyl]oxycarbonylamino]methyl]-2,9-dimethyl-8-(2-morpholin-4-ylethylcarbamoyl)decan-5-yl]carbamate (PubChem CID 67752843) has the molecular formula C36H63N5O9 and a molecular weight of 709.93 g/mol. Its IUPAC name is tert-butyl N-[(3S,5S,6S,8S)-6-hydroxy-3-[[[3-(4-methoxybutoxy)-2-pyridinyl]oxycarbonylamino]methyl]-2,9-dimethyl-8-(2-morpholin-4-ylethylcarbamoyl)decan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5S,6S,8S)-6-hydroxy-3-[[[3-(4-methoxybutoxy)-2-pyridinyl]oxycarbonylamino]methyl]-2,9-dimethyl-8-(2-morpholin-4-ylethylcarbamoyl)decan-5-yl]carbamate |
|---|---|
| PubChem CID | 67752843 |
| Molecular Formula | C36H63N5O9 |
| Molecular Weight | 709.93 g/mol |
| Exact Mass | 709.46 |
| IUPAC Name | tert-butyl N-[(3S,5S,6S,8S)-6-hydroxy-3-[[[3-(4-methoxybutoxy)-2-pyridinyl]oxycarbonylamino]methyl]-2,9-dimethyl-8-(2-morpholin-4-ylethylcarbamoyl)decan-5-yl]carbamate |
| SMILES | COCCCCOc1cccnc1OC(=O)NC[C@@H](C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)C[C@H](C(=O)NCCN1CCOCC1)C(C)C)C(C)C |
| InChI | InChI=1S/C36H63N5O9/c1-25(2)27(24-39-34(44)49-33-31(12-11-13-38-33)48-19-10-9-18-46-8)22-29(40-35(45)50-36(5,6)7)30(42)23-28(26(3)4)32(43)37-14-15-41-16-20-47-21-17-41/h11-13,25-30,42H,9-10,14-24H2,1-8H3,(H,37,43)(H,39,44)(H,40,45)/t27-,28+,29+,30+/m1/s1 |
| InChIKey | XAKQCEHMOBUYLW-RYTSNQFKSA-N |
| XLogP | 4.00 |
| TPSA | 169.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.93 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|