C27H45N3O5 — CID 135686652
tert-butyl N-[(2S,3S,5R)-3-hydroxy-6-methyl-5-(3-morpholin-4-ylpropylcarbamoyl)-1-phenylheptan-2-yl]carbamate (PubChem CID 135686652) has the molecular formula C27H45N3O5 and a molecular weight of 491.67 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,5R)-3-hydroxy-6-methyl-5-(3-morpholin-4-ylpropylcarbamoyl)-1-phenylheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,5R)-3-hydroxy-6-methyl-5-(3-morpholin-4-ylpropylcarbamoyl)-1-phenylheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 135686652 |
| Molecular Formula | C27H45N3O5 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | tert-butyl N-[(2S,3S,5R)-3-hydroxy-6-methyl-5-(3-morpholin-4-ylpropylcarbamoyl)-1-phenylheptan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](C[C@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C27H45N3O5/c1-20(2)22(25(32)28-12-9-13-30-14-16-34-17-15-30)19-24(31)23(18-21-10-7-6-8-11-21)29-26(33)35-27(3,4)5/h6-8,10-11,20,22-24,31H,9,12-19H2,1-5H3,(H,28,32)(H,29,33)/t22-,23+,24+/m1/s1 |
| InChIKey | IZQJMQOPCRFWSK-SGNDLWITSA-N |
| XLogP | 2.98 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|