C38H65N5O7 — CID 57255356
tert-butyl N-[(3S,5S,6S,8S)-3-[[[2-[2-(4-acetylpiperazin-1-yl)ethoxy]benzoyl]amino]methyl]-8-(butylcarbamoyl)-6-hydroxy-2,9-dimethyldecan-5-yl]carbamate (PubChem CID 57255356) has the molecular formula C38H65N5O7 and a molecular weight of 703.97 g/mol. Its IUPAC name is tert-butyl N-[(3S,5S,6S,8S)-3-[[[2-[2-(4-acetylpiperazin-1-yl)ethoxy]benzoyl]amino]methyl]-8-(butylcarbamoyl)-6-hydroxy-2,9-dimethyldecan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5S,6S,8S)-3-[[[2-[2-(4-acetylpiperazin-1-yl)ethoxy]benzoyl]amino]methyl]-8-(butylcarbamoyl)-6-hydroxy-2,9-dimethyldecan-5-yl]carbamate |
|---|---|
| PubChem CID | 57255356 |
| Molecular Formula | C38H65N5O7 |
| Molecular Weight | 703.97 g/mol |
| Exact Mass | 703.49 |
| IUPAC Name | tert-butyl N-[(3S,5S,6S,8S)-3-[[[2-[2-(4-acetylpiperazin-1-yl)ethoxy]benzoyl]amino]methyl]-8-(butylcarbamoyl)-6-hydroxy-2,9-dimethyldecan-5-yl]carbamate |
| SMILES | CCCCNC(=O)[C@@H](C[C@H](O)[C@H](CC(CNC(=O)c1ccccc1OCCN1CCN(C(C)=O)CC1)C(C)C)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C38H65N5O7/c1-10-11-16-39-36(47)31(27(4)5)24-33(45)32(41-37(48)50-38(7,8)9)23-29(26(2)3)25-40-35(46)30-14-12-13-15-34(30)49-22-21-42-17-19-43(20-18-42)28(6)44/h12-15,26-27,29,31-33,45H,10-11,16-25H2,1-9H3,(H,39,47)(H,40,46)(H,41,48)/t29?,31-,32-,33-/m0/s1 |
| InChIKey | HPJZUNSLOSKYNR-DJJFYYMISA-N |
| XLogP | 4.45 |
| TPSA | 149.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.97 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|