C38H66N4O6 — CID 56982946
tert-butyl N-[(3S,5S,6S,8S)-8-(butylcarbamoyl)-6-hydroxy-3-[[[2-[2-(4-methoxypiperidin-1-yl)ethyl]benzoyl]amino]methyl]-2,9-dimethyldecan-5-yl]carbamate (PubChem CID 56982946) has the molecular formula C38H66N4O6 and a molecular weight of 674.97 g/mol. Its IUPAC name is tert-butyl N-[(3S,5S,6S,8S)-8-(butylcarbamoyl)-6-hydroxy-3-[[[2-[2-(4-methoxypiperidin-1-yl)ethyl]benzoyl]amino]methyl]-2,9-dimethyldecan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5S,6S,8S)-8-(butylcarbamoyl)-6-hydroxy-3-[[[2-[2-(4-methoxypiperidin-1-yl)ethyl]benzoyl]amino]methyl]-2,9-dimethyldecan-5-yl]carbamate |
|---|---|
| PubChem CID | 56982946 |
| Molecular Formula | C38H66N4O6 |
| Molecular Weight | 674.97 g/mol |
| Exact Mass | 674.50 |
| IUPAC Name | tert-butyl N-[(3S,5S,6S,8S)-8-(butylcarbamoyl)-6-hydroxy-3-[[[2-[2-(4-methoxypiperidin-1-yl)ethyl]benzoyl]amino]methyl]-2,9-dimethyldecan-5-yl]carbamate |
| SMILES | CCCCNC(=O)[C@@H](C[C@H](O)[C@H](C[C@H](CNC(=O)c1ccccc1CCN1CCC(OC)CC1)C(C)C)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C38H66N4O6/c1-10-11-19-39-36(45)32(27(4)5)24-34(43)33(41-37(46)48-38(6,7)8)23-29(26(2)3)25-40-35(44)31-15-13-12-14-28(31)16-20-42-21-17-30(47-9)18-22-42/h12-15,26-27,29-30,32-34,43H,10-11,16-25H2,1-9H3,(H,39,45)(H,40,44)(H,41,46)/t29-,32+,33+,34+/m1/s1 |
| InChIKey | CIWTYKQFOBMYNR-HOWKLTHKSA-N |
| XLogP | 5.56 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.97 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|