C26H47ClN2O2 — CID 67802711
(2R,4S,5S,7S)-5-amino-N-butyl-7-[(4-tert-butylphenyl)methyl]-4-hydroxy-2,8-dimethylnonanamide;hydrochloride (PubChem CID 67802711) has the molecular formula C26H47ClN2O2 and a molecular weight of 455.13 g/mol. Its IUPAC name is (2R,4S,5S,7S)-5-amino-N-butyl-7-[(4-tert-butylphenyl)methyl]-4-hydroxy-2,8-dimethylnonanamide;hydrochloride.
| Compound Name | (2R,4S,5S,7S)-5-amino-N-butyl-7-[(4-tert-butylphenyl)methyl]-4-hydroxy-2,8-dimethylnonanamide;hydrochloride |
|---|---|
| PubChem CID | 67802711 |
| Molecular Formula | C26H47ClN2O2 |
| Molecular Weight | 455.13 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | (2R,4S,5S,7S)-5-amino-N-butyl-7-[(4-tert-butylphenyl)methyl]-4-hydroxy-2,8-dimethylnonanamide;hydrochloride |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)C[C@H](Cc1ccc(C(C)(C)C)cc1)C(C)C.Cl |
| InChI | InChI=1S/C26H46N2O2.ClH/c1-8-9-14-28-25(30)19(4)15-24(29)23(27)17-21(18(2)3)16-20-10-12-22(13-11-20)26(5,6)7;/h10-13,18-19,21,23-24,29H,8-9,14-17,27H2,1-7H3,(H,28,30);1H/t19-,21+,23+,24+;/m1./s1 |
| InChIKey | ZTUPGRATCSFRFS-HIZAEGLSSA-N |
| XLogP | 5.24 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.13 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|