C28H50ClN3O4 — CID 45263616
(2R,4S,5S,7S)-5-amino-7-[[3-(2-amino-2-oxoethoxy)-4-tert-butylphenyl]methyl]-N-butyl-4-hydroxy-2,8-dimethylnonanamide;hydrochloride (PubChem CID 45263616) has the molecular formula C28H50ClN3O4 and a molecular weight of 528.18 g/mol. Its IUPAC name is (2R,4S,5S,7S)-5-amino-7-[[3-(2-amino-2-oxoethoxy)-4-tert-butylphenyl]methyl]-N-butyl-4-hydroxy-2,8-dimethylnonanamide;hydrochloride.
| Compound Name | (2R,4S,5S,7S)-5-amino-7-[[3-(2-amino-2-oxoethoxy)-4-tert-butylphenyl]methyl]-N-butyl-4-hydroxy-2,8-dimethylnonanamide;hydrochloride |
|---|---|
| PubChem CID | 45263616 |
| Molecular Formula | C28H50ClN3O4 |
| Molecular Weight | 528.18 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | (2R,4S,5S,7S)-5-amino-7-[[3-(2-amino-2-oxoethoxy)-4-tert-butylphenyl]methyl]-N-butyl-4-hydroxy-2,8-dimethylnonanamide;hydrochloride |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)C[C@H](Cc1ccc(C(C)(C)C)c(OCC(N)=O)c1)C(C)C.Cl |
| InChI | InChI=1S/C28H49N3O4.ClH/c1-8-9-12-31-27(34)19(4)13-24(32)23(29)16-21(18(2)3)14-20-10-11-22(28(5,6)7)25(15-20)35-17-26(30)33;/h10-11,15,18-19,21,23-24,32H,8-9,12-14,16-17,29H2,1-7H3,(H2,30,33)(H,31,34);1H/t19-,21+,23+,24+;/m1./s1 |
| InChIKey | CHVSTRRGRIHDQY-HIZAEGLSSA-N |
| XLogP | 4.11 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|